C25H35N3O5S — CID 54534379
(2R,3R)-N-hydroxy-5-methyl-2-[[methyl(naphthalen-2-ylsulfonyl)amino]methyl]-3-(piperidine-1-carbonyl)hexanamide (PubChem CID 54534379) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is (2R,3R)-N-hydroxy-5-methyl-2-[[methyl(naphthalen-2-ylsulfonyl)amino]methyl]-3-(piperidine-1-carbonyl)hexanamide.
| Compound Name | (2R,3R)-N-hydroxy-5-methyl-2-[[methyl(naphthalen-2-ylsulfonyl)amino]methyl]-3-(piperidine-1-carbonyl)hexanamide |
|---|---|
| PubChem CID | 54534379 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (2R,3R)-N-hydroxy-5-methyl-2-[[methyl(naphthalen-2-ylsulfonyl)amino]methyl]-3-(piperidine-1-carbonyl)hexanamide |
| SMILES | CC(C)C[C@@H](C(=O)N1CCCCC1)[C@H](CN(C)S(=O)(=O)c1ccc2ccccc2c1)C(=O)NO |
| InChI | InChI=1S/C25H35N3O5S/c1-18(2)15-22(25(30)28-13-7-4-8-14-28)23(24(29)26-31)17-27(3)34(32,33)21-12-11-19-9-5-6-10-20(19)16-21/h5-6,9-12,16,18,22-23,31H,4,7-8,13-15,17H2,1-3H3,(H,26,29)/t22-,23+/m1/s1 |
| InChIKey | YYTDNSUDXYVRPG-PKTZIBPZSA-N |
| XLogP | 3.26 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|