C39H38F2N2O2 — CID 18397460
(2R)-1-[4-(7-cyclopropyl-9,10-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperazin-1-yl]-3-phenanthren-1-yloxypropan-2-ol (PubChem CID 18397460) has the molecular formula C39H38F2N2O2 and a molecular weight of 604.74 g/mol. Its IUPAC name is (2R)-1-[4-(7-cyclopropyl-9,10-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperazin-1-yl]-3-phenanthren-1-yloxypropan-2-ol.
| Compound Name | (2R)-1-[4-(7-cyclopropyl-9,10-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperazin-1-yl]-3-phenanthren-1-yloxypropan-2-ol |
|---|---|
| PubChem CID | 18397460 |
| Molecular Formula | C39H38F2N2O2 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | (2R)-1-[4-(7-cyclopropyl-9,10-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperazin-1-yl]-3-phenanthren-1-yloxypropan-2-ol |
| SMILES | O[C@@H](COc1cccc2c1ccc1ccccc12)CN1CCN(C2c3ccccc3C(F)C(F)c3c(C4CC4)cccc32)CC1 |
| InChI | InChI=1S/C39H38F2N2O2/c40-37-32-9-3-4-10-33(32)39(34-13-5-11-29(26-15-16-26)36(34)38(37)41)43-21-19-42(20-22-43)23-27(44)24-45-35-14-6-12-30-28-8-2-1-7-25(28)17-18-31(30)35/h1-14,17-18,26-27,37-39,44H,15-16,19-24H2/t27-,37?,38?,39?/m1/s1 |
| InChIKey | BRZXYNFAIQQDKP-IJZWMMKTSA-N |
| XLogP | 8.05 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|