C23H23N5O3S — CID 18400072
2-[4-[(2-butyl-5-cyano-4-methoxyimidazol-1-yl)methyl]phenyl]-N-cyanobenzenesulfonamide (PubChem CID 18400072) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is 2-[4-[(2-butyl-5-cyano-4-methoxyimidazol-1-yl)methyl]phenyl]-N-cyanobenzenesulfonamide.
| Compound Name | 2-[4-[(2-butyl-5-cyano-4-methoxyimidazol-1-yl)methyl]phenyl]-N-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 18400072 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 2-[4-[(2-butyl-5-cyano-4-methoxyimidazol-1-yl)methyl]phenyl]-N-cyanobenzenesulfonamide |
| SMILES | CCCCc1nc(OC)c(C#N)n1Cc1ccc(-c2ccccc2S(=O)(=O)NC#N)cc1 |
| InChI | InChI=1S/C23H23N5O3S/c1-3-4-9-22-27-23(31-2)20(14-24)28(22)15-17-10-12-18(13-11-17)19-7-5-6-8-21(19)32(29,30)26-16-25/h5-8,10-13,26H,3-4,9,15H2,1-2H3 |
| InChIKey | HMHGQNAKOFKHKI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|