C19H19N3O2 — CID 18400975
(E)-2-phenyl-3-[6-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid (PubChem CID 18400975) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is (E)-2-phenyl-3-[6-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid.
| Compound Name | (E)-2-phenyl-3-[6-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 18400975 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (E)-2-phenyl-3-[6-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoic acid |
| SMILES | CC(C)Nc1ccc2c(/C=C(/C(=O)O)c3ccccc3)c[nH]c2n1 |
| InChI | InChI=1S/C19H19N3O2/c1-12(2)21-17-9-8-15-14(11-20-18(15)22-17)10-16(19(23)24)13-6-4-3-5-7-13/h3-12H,1-2H3,(H,23,24)(H2,20,21,22)/b16-10+ |
| InChIKey | LWERWOOUBOOXIK-MHWRWJLKSA-N |
| XLogP | 4.01 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|