C23H19N5O2 — CID 69375910
3-amino-N-[3-[(Z)-3-amino-3-oxo-2-phenylprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]benzamide (PubChem CID 69375910) has the molecular formula C23H19N5O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 3-amino-N-[3-[(Z)-3-amino-3-oxo-2-phenylprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]benzamide.
| Compound Name | 3-amino-N-[3-[(Z)-3-amino-3-oxo-2-phenylprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]benzamide |
|---|---|
| PubChem CID | 69375910 |
| Molecular Formula | C23H19N5O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-amino-N-[3-[(Z)-3-amino-3-oxo-2-phenylprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]benzamide |
| SMILES | NC(=O)/C(=C\c1c[nH]c2nc(NC(=O)c3cccc(N)c3)ccc12)c1ccccc1 |
| InChI | InChI=1S/C23H19N5O2/c24-17-8-4-7-15(11-17)23(30)28-20-10-9-18-16(13-26-22(18)27-20)12-19(21(25)29)14-5-2-1-3-6-14/h1-13H,24H2,(H2,25,29)(H2,26,27,28,30)/b19-12- |
| InChIKey | AZQHMZAOUVPBCI-UNOMPAQXSA-N |
| XLogP | 3.42 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|