C28H22N4O2S — CID 69375987
(Z)-2-phenyl-3-[6-[[2-(4-thiophen-2-ylphenyl)acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide (PubChem CID 69375987) has the molecular formula C28H22N4O2S and a molecular weight of 478.58 g/mol. Its IUPAC name is (Z)-2-phenyl-3-[6-[[2-(4-thiophen-2-ylphenyl)acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide.
| Compound Name | (Z)-2-phenyl-3-[6-[[2-(4-thiophen-2-ylphenyl)acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 69375987 |
| Molecular Formula | C28H22N4O2S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | (Z)-2-phenyl-3-[6-[[2-(4-thiophen-2-ylphenyl)acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
| SMILES | NC(=O)/C(=C\c1c[nH]c2nc(NC(=O)Cc3ccc(-c4cccs4)cc3)ccc12)c1ccccc1 |
| InChI | InChI=1S/C28H22N4O2S/c29-27(34)23(19-5-2-1-3-6-19)16-21-17-30-28-22(21)12-13-25(32-28)31-26(33)15-18-8-10-20(11-9-18)24-7-4-14-35-24/h1-14,16-17H,15H2,(H2,29,34)(H2,30,31,32,33)/b23-16- |
| InChIKey | YFKWFPWLNFCDKF-KQWNVCNZSA-N |
| XLogP | 5.50 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|