C24H34O3 — CID 18401178
4-methoxy-2-[3-methoxy-5-(2-methylbutan-2-yl)phenyl]-6-(2-methylbutan-2-yl)phenol (PubChem CID 18401178) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is 4-methoxy-2-[3-methoxy-5-(2-methylbutan-2-yl)phenyl]-6-(2-methylbutan-2-yl)phenol.
| Compound Name | 4-methoxy-2-[3-methoxy-5-(2-methylbutan-2-yl)phenyl]-6-(2-methylbutan-2-yl)phenol |
|---|---|
| PubChem CID | 18401178 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 4-methoxy-2-[3-methoxy-5-(2-methylbutan-2-yl)phenyl]-6-(2-methylbutan-2-yl)phenol |
| SMILES | CCC(C)(C)c1cc(OC)cc(-c2cc(OC)cc(C(C)(C)CC)c2O)c1 |
| InChI | InChI=1S/C24H34O3/c1-9-23(3,4)17-11-16(12-18(13-17)26-7)20-14-19(27-8)15-21(22(20)25)24(5,6)10-2/h11-15,25H,9-10H2,1-8H3 |
| InChIKey | MLJCSVLYQXYDLW-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |