C24H15ClN4O4 — CID 18401508
2-[[8-chloro-1-(4-nitrophenyl)-5H-2,3-benzodiazepin-4-yl]methyl]isoindole-1,3-dione (PubChem CID 18401508) has the molecular formula C24H15ClN4O4 and a molecular weight of 458.86 g/mol. Its IUPAC name is 2-[[8-chloro-1-(4-nitrophenyl)-5H-2,3-benzodiazepin-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[8-chloro-1-(4-nitrophenyl)-5H-2,3-benzodiazepin-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18401508 |
| Molecular Formula | C24H15ClN4O4 |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 2-[[8-chloro-1-(4-nitrophenyl)-5H-2,3-benzodiazepin-4-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC1=NN=C(c2ccc([N+](=O)[O-])cc2)c2cc(Cl)ccc2C1 |
| InChI | InChI=1S/C24H15ClN4O4/c25-16-8-5-15-11-17(13-28-23(30)19-3-1-2-4-20(19)24(28)31)26-27-22(21(15)12-16)14-6-9-18(10-7-14)29(32)33/h1-10,12H,11,13H2 |
| InChIKey | FFMZXRCILMPLMV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 105.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|