C15H11ClN2O2 — CID 22640620
7-chloro-1-(3-nitrophenyl)-3,4-dihydroisoquinoline (PubChem CID 22640620) has the molecular formula C15H11ClN2O2 and a molecular weight of 286.72 g/mol. Its IUPAC name is 7-chloro-1-(3-nitrophenyl)-3,4-dihydroisoquinoline.
| Compound Name | 7-chloro-1-(3-nitrophenyl)-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 22640620 |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 7-chloro-1-(3-nitrophenyl)-3,4-dihydroisoquinoline |
| SMILES | O=[N+]([O-])c1cccc(C2=NCCc3ccc(Cl)cc32)c1 |
| InChI | InChI=1S/C15H11ClN2O2/c16-12-5-4-10-6-7-17-15(14(10)9-12)11-2-1-3-13(8-11)18(19)20/h1-5,8-9H,6-7H2 |
| InChIKey | VAOHAEPVPPSDCU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|