C25H28N2O4 — CID 18403269
3-[(2-methyl-2-azabicyclo[2.2.2]octan-3-yl)methyl]-2-phenyl-1H-indole;oxalic acid (PubChem CID 18403269) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-[(2-methyl-2-azabicyclo[2.2.2]octan-3-yl)methyl]-2-phenyl-1H-indole;oxalic acid.
| Compound Name | 3-[(2-methyl-2-azabicyclo[2.2.2]octan-3-yl)methyl]-2-phenyl-1H-indole;oxalic acid |
|---|---|
| PubChem CID | 18403269 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-[(2-methyl-2-azabicyclo[2.2.2]octan-3-yl)methyl]-2-phenyl-1H-indole;oxalic acid |
| SMILES | CN1C2CCC(CC2)C1Cc1c(-c2ccccc2)[nH]c2ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H26N2.C2H2O4/c1-25-18-13-11-16(12-14-18)22(25)15-20-19-9-5-6-10-21(19)24-23(20)17-7-3-2-4-8-17;3-1(4)2(5)6/h2-10,16,18,22,24H,11-15H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | YJAKKEBZZHWQPP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|