C24H25Cl2N3O5 — CID 18403473
(4E)-5,7-dichloro-4-[2-[4-[2-(2-methylpropanoylamino)ethoxy]anilino]-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid (PubChem CID 18403473) has the molecular formula C24H25Cl2N3O5 and a molecular weight of 506.39 g/mol. Its IUPAC name is (4E)-5,7-dichloro-4-[2-[4-[2-(2-methylpropanoylamino)ethoxy]anilino]-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid.
| Compound Name | (4E)-5,7-dichloro-4-[2-[4-[2-(2-methylpropanoylamino)ethoxy]anilino]-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 18403473 |
| Molecular Formula | C24H25Cl2N3O5 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | (4E)-5,7-dichloro-4-[2-[4-[2-(2-methylpropanoylamino)ethoxy]anilino]-2-oxoethylidene]-2,3-dihydro-1H-quinoline-2-carboxylic acid |
| SMILES | CC(C)C(=O)NCCOc1ccc(NC(=O)/C=C2\CC(C(=O)O)Nc3cc(Cl)cc(Cl)c32)cc1 |
| InChI | InChI=1S/C24H25Cl2N3O5/c1-13(2)23(31)27-7-8-34-17-5-3-16(4-6-17)28-21(30)10-14-9-20(24(32)33)29-19-12-15(25)11-18(26)22(14)19/h3-6,10-13,20,29H,7-9H2,1-2H3,(H,27,31)(H,28,30)(H,32,33)/b14-10+ |
| InChIKey | NDCNGBDIESACLR-GXDHUFHOSA-N |
| XLogP | 4.44 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|