C30H39N3O3 — CID 18405536
3-[[5-[3-(1-adamantyl)propyl]-2-cyclohexyl-1H-imidazole-4-carbonyl]amino]benzoic acid (PubChem CID 18405536) has the molecular formula C30H39N3O3 and a molecular weight of 489.66 g/mol. Its IUPAC name is 3-[[5-[3-(1-adamantyl)propyl]-2-cyclohexyl-1H-imidazole-4-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[5-[3-(1-adamantyl)propyl]-2-cyclohexyl-1H-imidazole-4-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18405536 |
| Molecular Formula | C30H39N3O3 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | 3-[[5-[3-(1-adamantyl)propyl]-2-cyclohexyl-1H-imidazole-4-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2nc(C3CCCCC3)[nH]c2CCCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C30H39N3O3/c34-28(31-24-9-4-8-23(15-24)29(35)36)26-25(32-27(33-26)22-6-2-1-3-7-22)10-5-11-30-16-19-12-20(17-30)14-21(13-19)18-30/h4,8-9,15,19-22H,1-3,5-7,10-14,16-18H2,(H,31,34)(H,32,33)(H,35,36) |
| InChIKey | OLGWYWCYJCSZFO-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |