C27H34N4O4 — CID 10116585
3-[[5-(1-adamantyloxymethyl)-2-cyclohexyltriazole-4-carbonyl]amino]benzoic acid (PubChem CID 10116585) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 3-[[5-(1-adamantyloxymethyl)-2-cyclohexyltriazole-4-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[5-(1-adamantyloxymethyl)-2-cyclohexyltriazole-4-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10116585 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 3-[[5-(1-adamantyloxymethyl)-2-cyclohexyltriazole-4-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2nn(C3CCCCC3)nc2COC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C27H34N4O4/c32-25(28-21-6-4-5-20(12-21)26(33)34)24-23(29-31(30-24)22-7-2-1-3-8-22)16-35-27-13-17-9-18(14-27)11-19(10-17)15-27/h4-6,12,17-19,22H,1-3,7-11,13-16H2,(H,28,32)(H,33,34) |
| InChIKey | MNKQPQZCCAJPOQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |