C30H35N3O4 — CID 18405503
3-[[5-(1-adamantyloxymethyl)-2-(1-bicyclo[2.2.2]oct-2-enyl)-1H-imidazole-4-carbonyl]amino]benzoic acid (PubChem CID 18405503) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is 3-[[5-(1-adamantyloxymethyl)-2-(1-bicyclo[2.2.2]oct-2-enyl)-1H-imidazole-4-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[5-(1-adamantyloxymethyl)-2-(1-bicyclo[2.2.2]oct-2-enyl)-1H-imidazole-4-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18405503 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 3-[[5-(1-adamantyloxymethyl)-2-(1-bicyclo[2.2.2]oct-2-enyl)-1H-imidazole-4-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2nc(C34C=CC(CC3)CC4)[nH]c2COC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C30H35N3O4/c34-26(31-23-3-1-2-22(13-23)27(35)36)25-24(32-28(33-25)29-7-4-18(5-8-29)6-9-29)17-37-30-14-19-10-20(15-30)12-21(11-19)16-30/h1-4,7,13,18-21H,5-6,8-12,14-17H2,(H,31,34)(H,32,33)(H,35,36) |
| InChIKey | AEDQYRINDDSINR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|