C31H38N4O4 — CID 10143203
3-[[2-(1-adamantyl)-5-(1-adamantyloxymethyl)triazole-4-carbonyl]amino]benzoic acid (PubChem CID 10143203) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is 3-[[2-(1-adamantyl)-5-(1-adamantyloxymethyl)triazole-4-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[2-(1-adamantyl)-5-(1-adamantyloxymethyl)triazole-4-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10143203 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 3-[[2-(1-adamantyl)-5-(1-adamantyloxymethyl)triazole-4-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2nn(C34CC5CC(CC(C5)C3)C4)nc2COC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C31H38N4O4/c36-28(32-25-3-1-2-24(10-25)29(37)38)27-26(17-39-31-14-21-7-22(15-31)9-23(8-21)16-31)33-35(34-27)30-11-18-4-19(12-30)6-20(5-18)13-30/h1-3,10,18-23H,4-9,11-17H2,(H,32,36)(H,37,38) |
| InChIKey | XXSSRBYRPWNCAB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |