C25H33N3O3 — CID 18405616
3-[[2-cyclohexyl-5-(2-cyclohexylethyl)-1H-imidazole-4-carbonyl]amino]benzoic acid (PubChem CID 18405616) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 3-[[2-cyclohexyl-5-(2-cyclohexylethyl)-1H-imidazole-4-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[2-cyclohexyl-5-(2-cyclohexylethyl)-1H-imidazole-4-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18405616 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 3-[[2-cyclohexyl-5-(2-cyclohexylethyl)-1H-imidazole-4-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2nc(C3CCCCC3)[nH]c2CCC2CCCCC2)c1 |
| InChI | InChI=1S/C25H33N3O3/c29-24(26-20-13-7-12-19(16-20)25(30)31)22-21(15-14-17-8-3-1-4-9-17)27-23(28-22)18-10-5-2-6-11-18/h7,12-13,16-18H,1-6,8-11,14-15H2,(H,26,29)(H,27,28)(H,30,31) |
| InChIKey | RBXZWIOYNBGJCK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |