About 2,3-diethylaniline;pyrene
2,3-diethylaniline;pyrene (PubChem CID 18406401) has the molecular formula C26H25N
and a molecular weight of 351.49 g/mol. Its IUPAC name is 2,3-diethylaniline;pyrene.
Molecular Properties
| Compound Name | 2,3-diethylaniline;pyrene |
| PubChem CID | 18406401 |
| Molecular Formula | C26H25N |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2,3-diethylaniline;pyrene |
| SMILES | CCc1cccc(N)c1CC.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C10H15N/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-3-8-6-5-7-10(11)9(8)4-2/h1-10H;5-7H,3-4,11H2,1-2H3 |
| InChIKey | DWSNTBXYGXHGRN-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diethylaniline;pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethylaniline;pyrene?
The IUPAC name of 2,3-diethylaniline;pyrene (CID 18406401) is 2,3-diethylaniline;pyrene.
What is the SMILES notation for 2,3-diethylaniline;pyrene?
The canonical SMILES for 2,3-diethylaniline;pyrene is CCc1cccc(N)c1CC.c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of 2,3-diethylaniline;pyrene?
The InChIKey is DWSNTBXYGXHGRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C10H15N/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-3-8-6-5-7-10(11)9(8)4-2/h1-10H;5-7H,3-4,11H2,1-2H3.
What are the key properties of 2,3-diethylaniline;pyrene?
2,3-diethylaniline;pyrene has a molecular weight of 351.49 g/mol, XLogP of 6.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethylaniline;pyrene is sourced from PubChem (CID 18406401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).