C4H5F2N3 — CID 18406943
1-(2,2-difluoroethyl)-1,2,4-triazole (PubChem CID 18406943) has the molecular formula C4H5F2N3 and a molecular weight of 133.10 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-1,2,4-triazole.
| Compound Name | 1-(2,2-difluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 18406943 |
| Molecular Formula | C4H5F2N3 |
| Molecular Weight | 133.10 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 1-(2,2-difluoroethyl)-1,2,4-triazole |
| SMILES | FC(F)Cn1cncn1 |
| InChI | InChI=1S/C4H5F2N3/c5-4(6)1-9-3-7-2-8-9/h2-4H,1H2 |
| InChIKey | KCGWXYSJUZTOCO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.10 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |