C8H13F3N3+ — CID 156600083
1-propyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium (PubChem CID 156600083) has the molecular formula C8H13F3N3+ and a molecular weight of 208.21 g/mol. Its IUPAC name is 1-propyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium.
| Compound Name | 1-propyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 156600083 |
| Molecular Formula | C8H13F3N3+ |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1-propyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium |
| SMILES | CCCn1c[n+](CCC(F)(F)F)cn1 |
| InChI | InChI=1S/C8H13F3N3/c1-2-4-14-7-13(6-12-14)5-3-8(9,10)11/h6-7H,2-5H2,1H3/q+1 |
| InChIKey | ZBBZQMKRFQTLDK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|