C17H21F13N3+ — CID 156600037
4-heptyl-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium (PubChem CID 156600037) has the molecular formula C17H21F13N3+ and a molecular weight of 514.35 g/mol. Its IUPAC name is 4-heptyl-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium.
| Compound Name | 4-heptyl-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 156600037 |
| Molecular Formula | C17H21F13N3+ |
| Molecular Weight | 514.35 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 4-heptyl-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium |
| SMILES | CCCCCCC[n+]1cnn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F13N3/c1-2-3-4-5-6-8-32-10-31-33(11-32)9-7-12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h10-11H,2-9H2,1H3/q+1 |
| InChIKey | MGTADQAPELIOHD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.35 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|