C20H27F13N3+ — CID 156600023
4-decyl-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium (PubChem CID 156600023) has the molecular formula C20H27F13N3+ and a molecular weight of 556.43 g/mol. Its IUPAC name is 4-decyl-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium.
| Compound Name | 4-decyl-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 156600023 |
| Molecular Formula | C20H27F13N3+ |
| Molecular Weight | 556.43 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 4-decyl-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium |
| SMILES | CCCCCCCCCC[n+]1cnn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H27F13N3/c1-2-3-4-5-6-7-8-9-11-35-13-34-36(14-35)12-10-15(21,22)16(23,24)17(25,26)18(27,28)19(29,30)20(31,32)33/h13-14H,2-12H2,1H3/q+1 |
| InChIKey | HYPXOGWDTVPVFD-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.43 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|