About benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane
benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane (PubChem CID 18410041) has the molecular formula C9H6N3O6PS
and a molecular weight of 315.20 g/mol. Its IUPAC name is benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane.
Molecular Properties
| Compound Name | benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane |
| PubChem CID | 18410041 |
| Molecular Formula | C9H6N3O6PS |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane |
| SMILES | O=C=NOP(=S)(ON=C=O)ON=C=O.c1ccccc1 |
| InChI | InChI=1S/C6H6.C3N3O6PS/c1-2-4-6-5-3-1;7-1-4-10-13(14,11-5-2-8)12-6-3-9/h1-6H; |
| InChIKey | KAPFGIVRWYCDRZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane?
The IUPAC name of benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane (CID 18410041) is benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane.
What is the SMILES notation for benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane?
The canonical SMILES for benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane is O=C=NOP(=S)(ON=C=O)ON=C=O.c1ccccc1.
What is the InChIKey of benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane?
The InChIKey is KAPFGIVRWYCDRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.C3N3O6PS/c1-2-4-6-5-3-1;7-1-4-10-13(14,11-5-2-8)12-6-3-9/h1-6H;.
What are the key properties of benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane?
benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane has a molecular weight of 315.20 g/mol, XLogP of 1.70, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;triisocyanatooxy(sulfanylidene)-lambda5-phosphane is sourced from PubChem (CID 18410041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).