About chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone)
chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone) (PubChem CID 88761085) has the molecular formula C38H30ClIrO2P2+2
and a molecular weight of 808.27 g/mol. Its IUPAC name is chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone).
Molecular Properties
| Compound Name | chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone) |
| PubChem CID | 88761085 |
| Molecular Formula | C38H30ClIrO2P2+2 |
| Molecular Weight | 808.27 g/mol |
| Exact Mass | 808.10 |
| IUPAC Name | chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone) |
| SMILES | Cl[Ir+2].O=C=P(c1ccccc1)(c1ccccc1)c1ccccc1.O=C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C19H15OP.ClH.Ir/c2*20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;;/h2*1-15H;1H;/q;;;+3/p-1 |
| InChIKey | KYMYSDJPTWVWBV-UHFFFAOYSA-M |
| XLogP | 6.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 808.27 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone)?
The IUPAC name of chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone) (CID 88761085) is chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone).
What is the SMILES notation for chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone)?
The canonical SMILES for chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone) is Cl[Ir+2].O=C=P(c1ccccc1)(c1ccccc1)c1ccccc1.O=C=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone)?
The InChIKey is KYMYSDJPTWVWBV-UHFFFAOYSA-M. The full InChI is InChI=1S/2C19H15OP.ClH.Ir/c2*20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;;/h2*1-15H;1H;/q;;;+3/p-1.
What are the key properties of chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone)?
chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone) has a molecular weight of 808.27 g/mol, XLogP of 6.78, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroiridium(2+);bis((triphenyl-λ5-phosphanylidene)methanone) is sourced from PubChem (CID 88761085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).