About iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion
iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion (PubChem CID 50909156) has the molecular formula C18H15FeIN2O2P-2
and a molecular weight of 505.05 g/mol. Its IUPAC name is iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion.
Molecular Properties
| Compound Name | iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion |
| PubChem CID | 50909156 |
| Molecular Formula | C18H15FeIN2O2P-2 |
| Molecular Weight | 505.05 g/mol |
| Exact Mass | 504.93 |
| IUPAC Name | iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion |
| SMILES | I[Fe]=P(c1ccccc1)(c1ccccc1)c1ccccc1.[N-]=O.[N-]=O |
| InChI | InChI=1S/C18H15P.Fe.HI.2NO/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;2*1-2/h1-15H;;1H;;/q;+1;;2*-1/p-1 |
| InChIKey | CQWSTMRAIYVJOT-UHFFFAOYSA-M |
| XLogP | 4.97 |
| TPSA | 78.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 505.05 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion?
The IUPAC name of iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion (CID 50909156) is iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion.
What is the SMILES notation for iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion?
The canonical SMILES for iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion is I[Fe]=P(c1ccccc1)(c1ccccc1)c1ccccc1.[N-]=O.[N-]=O.
What is the InChIKey of iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion?
The InChIKey is CQWSTMRAIYVJOT-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15P.Fe.HI.2NO/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;2*1-2/h1-15H;;1H;;/q;+1;;2*-1/p-1.
What are the key properties of iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion?
iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion has a molecular weight of 505.05 g/mol, XLogP of 4.97, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iodo-(triphenyl-λ5-phosphanylidene)iron;nitroxyl anion is sourced from PubChem (CID 50909156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).