C15H23N3O6S — CID 18420242
4-(4-ethylpiperazin-1-yl)sulfonyl-2-(2-methoxyethoxy)pyridine-3-carboxylic acid (PubChem CID 18420242) has the molecular formula C15H23N3O6S and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)sulfonyl-2-(2-methoxyethoxy)pyridine-3-carboxylic acid.
| Compound Name | 4-(4-ethylpiperazin-1-yl)sulfonyl-2-(2-methoxyethoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 18420242 |
| Molecular Formula | C15H23N3O6S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)sulfonyl-2-(2-methoxyethoxy)pyridine-3-carboxylic acid |
| SMILES | CCN1CCN(S(=O)(=O)c2ccnc(OCCOC)c2C(=O)O)CC1 |
| InChI | InChI=1S/C15H23N3O6S/c1-3-17-6-8-18(9-7-17)25(21,22)12-4-5-16-14(13(12)15(19)20)24-11-10-23-2/h4-5H,3,6-11H2,1-2H3,(H,19,20) |
| InChIKey | SJYFCNZCSWHCAG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|