C15H24N4O5S — CID 141012525
5-(4-ethylpiperazin-1-yl)sulfonyl-2-(2-methoxyethoxy)pyridine-3-carboxamide (PubChem CID 141012525) has the molecular formula C15H24N4O5S and a molecular weight of 372.45 g/mol. Its IUPAC name is 5-(4-ethylpiperazin-1-yl)sulfonyl-2-(2-methoxyethoxy)pyridine-3-carboxamide.
| Compound Name | 5-(4-ethylpiperazin-1-yl)sulfonyl-2-(2-methoxyethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141012525 |
| Molecular Formula | C15H24N4O5S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 5-(4-ethylpiperazin-1-yl)sulfonyl-2-(2-methoxyethoxy)pyridine-3-carboxamide |
| SMILES | CCN1CCN(S(=O)(=O)c2cnc(OCCOC)c(C(N)=O)c2)CC1 |
| InChI | InChI=1S/C15H24N4O5S/c1-3-18-4-6-19(7-5-18)25(21,22)12-10-13(14(16)20)15(17-11-12)24-9-8-23-2/h10-11H,3-9H2,1-2H3,(H2,16,20) |
| InChIKey | MHMTYAPPXOYZBX-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|