C10H17N5O2S — CID 46360864
5-(4-ethylpiperazin-1-yl)sulfonylpyrimidin-2-amine (PubChem CID 46360864) has the molecular formula C10H17N5O2S and a molecular weight of 271.35 g/mol. Its IUPAC name is 5-(4-ethylpiperazin-1-yl)sulfonylpyrimidin-2-amine.
| Compound Name | 5-(4-ethylpiperazin-1-yl)sulfonylpyrimidin-2-amine |
|---|---|
| PubChem CID | 46360864 |
| Molecular Formula | C10H17N5O2S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 5-(4-ethylpiperazin-1-yl)sulfonylpyrimidin-2-amine |
| SMILES | CCN1CCN(S(=O)(=O)c2cnc(N)nc2)CC1 |
| InChI | InChI=1S/C10H17N5O2S/c1-2-14-3-5-15(6-4-14)18(16,17)9-7-12-10(11)13-8-9/h7-8H,2-6H2,1H3,(H2,11,12,13) |
| InChIKey | BLFSOISKATYQIG-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |