C9H15N5O4S2 — CID 62992250
5-(4-methylsulfonylpiperazin-1-yl)sulfonylpyrimidin-2-amine (PubChem CID 62992250) has the molecular formula C9H15N5O4S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 5-(4-methylsulfonylpiperazin-1-yl)sulfonylpyrimidin-2-amine.
| Compound Name | 5-(4-methylsulfonylpiperazin-1-yl)sulfonylpyrimidin-2-amine |
|---|---|
| PubChem CID | 62992250 |
| Molecular Formula | C9H15N5O4S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 5-(4-methylsulfonylpiperazin-1-yl)sulfonylpyrimidin-2-amine |
| SMILES | CS(=O)(=O)N1CCN(S(=O)(=O)c2cnc(N)nc2)CC1 |
| InChI | InChI=1S/C9H15N5O4S2/c1-19(15,16)13-2-4-14(5-3-13)20(17,18)8-6-11-9(10)12-7-8/h6-7H,2-5H2,1H3,(H2,10,11,12) |
| InChIKey | ZWXNKDQIKNCRBA-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |