C21H29N6O4+ — CID 18424586
2-[4-[2-(4-amino-N-hydroxyanilino)-2-oxoethyl]-4-methylpiperazin-4-ium-1-yl]-N-(4-aminophenyl)-N-hydroxyacetamide (PubChem CID 18424586) has the molecular formula C21H29N6O4+ and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-[4-[2-(4-amino-N-hydroxyanilino)-2-oxoethyl]-4-methylpiperazin-4-ium-1-yl]-N-(4-aminophenyl)-N-hydroxyacetamide.
| Compound Name | 2-[4-[2-(4-amino-N-hydroxyanilino)-2-oxoethyl]-4-methylpiperazin-4-ium-1-yl]-N-(4-aminophenyl)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 18424586 |
| Molecular Formula | C21H29N6O4+ |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-[4-[2-(4-amino-N-hydroxyanilino)-2-oxoethyl]-4-methylpiperazin-4-ium-1-yl]-N-(4-aminophenyl)-N-hydroxyacetamide |
| SMILES | C[N+]1(CC(=O)N(O)c2ccc(N)cc2)CCN(CC(=O)N(O)c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C21H29N6O4/c1-27(15-21(29)26(31)19-8-4-17(23)5-9-19)12-10-24(11-13-27)14-20(28)25(30)18-6-2-16(22)3-7-18/h2-9,30-31H,10-15,22-23H2,1H3/q+1 |
| InChIKey | GYLFAVCQOTXXSS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|