C22H27Cl2N3O — CID 18425361
3,4-dichloro-N-[3-[2-(4-methylpiperazin-1-yl)phenyl]butan-2-yl]benzamide (PubChem CID 18425361) has the molecular formula C22H27Cl2N3O and a molecular weight of 420.38 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[2-(4-methylpiperazin-1-yl)phenyl]butan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[2-(4-methylpiperazin-1-yl)phenyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 18425361 |
| Molecular Formula | C22H27Cl2N3O |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3,4-dichloro-N-[3-[2-(4-methylpiperazin-1-yl)phenyl]butan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccc(Cl)c(Cl)c1)C(C)c1ccccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C22H27Cl2N3O/c1-15(16(2)25-22(28)17-8-9-19(23)20(24)14-17)18-6-4-5-7-21(18)27-12-10-26(3)11-13-27/h4-9,14-16H,10-13H2,1-3H3,(H,25,28) |
| InChIKey | FAONBIJKTLNRDN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |