methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate

C11H12O2S2 — CID 18432367

IUPACmethyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate
SMILESCOC(=O)c1ccc2c(c1C)SCCS2
InChIInChI=1S/C11H12O2S2/c1-7-8(11(12)13-2)3-4-9-10(7)15-6-5-14-9/h3-4H,5-6H2,1-2H3
InChIKeyIOOXTOMDWAMXKM-UHFFFAOYSA-N
MW240.35 g/mol
LogP2.98
Rot. Bonds1

About methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate

methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate (PubChem CID 18432367) has the molecular formula C11H12O2S2 and a molecular weight of 240.35 g/mol. Its IUPAC name is methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate.

Molecular Properties

Compound Namemethyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate
PubChem CID18432367
Molecular FormulaC11H12O2S2
Molecular Weight240.35 g/mol
Exact Mass240.03
IUPAC Namemethyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate
SMILESCOC(=O)c1ccc2c(c1C)SCCS2
InChIInChI=1S/C11H12O2S2/c1-7-8(11(12)13-2)3-4-9-10(7)15-6-5-14-9/h3-4H,5-6H2,1-2H3
InChIKeyIOOXTOMDWAMXKM-UHFFFAOYSA-N
XLogP2.98
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.35
LogP ≤ 52.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate?
The IUPAC name of methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate (CID 18432367) is methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate.
What is the SMILES notation for methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate?
The canonical SMILES for methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate is COC(=O)c1ccc2c(c1C)SCCS2.
What is the InChIKey of methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate?
The InChIKey is IOOXTOMDWAMXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2S2/c1-7-8(11(12)13-2)3-4-9-10(7)15-6-5-14-9/h3-4H,5-6H2,1-2H3.
What are the key properties of methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate?
methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate has a molecular weight of 240.35 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-2,3-dihydro-1,4-benzodithiine-6-carboxylate is sourced from PubChem (CID 18432367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).