C22H29ClF3NO — CID 18435049
N-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]-4-fluorobutan-1-amine;hydrochloride (PubChem CID 18435049) has the molecular formula C22H29ClF3NO and a molecular weight of 415.93 g/mol. Its IUPAC name is N-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]-4-fluorobutan-1-amine;hydrochloride.
| Compound Name | N-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]-4-fluorobutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 18435049 |
| Molecular Formula | C22H29ClF3NO |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[3-[(2,6-difluorophenyl)methoxy]-2-(2,6-dimethylphenyl)propyl]-4-fluorobutan-1-amine;hydrochloride |
| SMILES | Cc1cccc(C)c1C(CNCCCCF)COCc1c(F)cccc1F.Cl |
| InChI | InChI=1S/C22H28F3NO.ClH/c1-16-7-5-8-17(2)22(16)18(13-26-12-4-3-11-23)14-27-15-19-20(24)9-6-10-21(19)25;/h5-10,18,26H,3-4,11-15H2,1-2H3;1H |
| InChIKey | FOCIIXCBFUSSFD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|