C29H29Cl2N3O4 — CID 18442567
2-[5-[(3,4-dichlorophenyl)methyl]-7,8-dimethoxy-2-oxo-3,5-dihydro-1H-1,4-benzodiazepin-4-yl]-N-(2,3-dihydro-1H-inden-1-yl)acetamide (PubChem CID 18442567) has the molecular formula C29H29Cl2N3O4 and a molecular weight of 554.47 g/mol. Its IUPAC name is 2-[5-[(3,4-dichlorophenyl)methyl]-7,8-dimethoxy-2-oxo-3,5-dihydro-1H-1,4-benzodiazepin-4-yl]-N-(2,3-dihydro-1H-inden-1-yl)acetamide.
| Compound Name | 2-[5-[(3,4-dichlorophenyl)methyl]-7,8-dimethoxy-2-oxo-3,5-dihydro-1H-1,4-benzodiazepin-4-yl]-N-(2,3-dihydro-1H-inden-1-yl)acetamide |
|---|---|
| PubChem CID | 18442567 |
| Molecular Formula | C29H29Cl2N3O4 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 2-[5-[(3,4-dichlorophenyl)methyl]-7,8-dimethoxy-2-oxo-3,5-dihydro-1H-1,4-benzodiazepin-4-yl]-N-(2,3-dihydro-1H-inden-1-yl)acetamide |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc(Cl)c(Cl)c1)N(CC(=O)NC1CCc3ccccc31)CC(=O)N2 |
| InChI | InChI=1S/C29H29Cl2N3O4/c1-37-26-13-20-24(14-27(26)38-2)33-29(36)16-34(25(20)12-17-7-9-21(30)22(31)11-17)15-28(35)32-23-10-8-18-5-3-4-6-19(18)23/h3-7,9,11,13-14,23,25H,8,10,12,15-16H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | SLOXRTVMSOONNY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |