C25H21N3O7S — CID 18444315
3,7-dihydroxy-N-[2-[4-[(4-nitrophenyl)sulfonylamino]phenyl]ethyl]naphthalene-2-carboxamide (PubChem CID 18444315) has the molecular formula C25H21N3O7S and a molecular weight of 507.52 g/mol. Its IUPAC name is 3,7-dihydroxy-N-[2-[4-[(4-nitrophenyl)sulfonylamino]phenyl]ethyl]naphthalene-2-carboxamide.
| Compound Name | 3,7-dihydroxy-N-[2-[4-[(4-nitrophenyl)sulfonylamino]phenyl]ethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18444315 |
| Molecular Formula | C25H21N3O7S |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 3,7-dihydroxy-N-[2-[4-[(4-nitrophenyl)sulfonylamino]phenyl]ethyl]naphthalene-2-carboxamide |
| SMILES | O=C(NCCc1ccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1)c1cc2cc(O)ccc2cc1O |
| InChI | InChI=1S/C25H21N3O7S/c29-21-8-3-17-15-24(30)23(14-18(17)13-21)25(31)26-12-11-16-1-4-19(5-2-16)27-36(34,35)22-9-6-20(7-10-22)28(32)33/h1-10,13-15,27,29-30H,11-12H2,(H,26,31) |
| InChIKey | NERVKDFTUQRHOU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 158.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|