C26H22N2O5 — CID 11189942
3-hydroxy-N-[2-[4-methoxy-3-(4-nitrophenyl)phenyl]ethyl]naphthalene-2-carboxamide (PubChem CID 11189942) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is 3-hydroxy-N-[2-[4-methoxy-3-(4-nitrophenyl)phenyl]ethyl]naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-N-[2-[4-methoxy-3-(4-nitrophenyl)phenyl]ethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 11189942 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 3-hydroxy-N-[2-[4-methoxy-3-(4-nitrophenyl)phenyl]ethyl]naphthalene-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2cc3ccccc3cc2O)cc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H22N2O5/c1-33-25-11-6-17(14-22(25)18-7-9-21(10-8-18)28(31)32)12-13-27-26(30)23-15-19-4-2-3-5-20(19)16-24(23)29/h2-11,14-16,29H,12-13H2,1H3,(H,27,30) |
| InChIKey | IDGPQAPVSRTZBY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|