C11H15BO4 — CID 18445420
[6-(2-methylpropyl)-1,3-benzodioxol-4-yl]boronic acid (PubChem CID 18445420) has the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. Its IUPAC name is [6-(2-methylpropyl)-1,3-benzodioxol-4-yl]boronic acid.
| Compound Name | [6-(2-methylpropyl)-1,3-benzodioxol-4-yl]boronic acid |
|---|---|
| PubChem CID | 18445420 |
| Molecular Formula | C11H15BO4 |
| Molecular Weight | 222.05 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | [6-(2-methylpropyl)-1,3-benzodioxol-4-yl]boronic acid |
| SMILES | CC(C)Cc1cc2c(c(B(O)O)c1)OCO2 |
| InChI | InChI=1S/C11H15BO4/c1-7(2)3-8-4-9(12(13)14)11-10(5-8)15-6-16-11/h4-5,7,13-14H,3,6H2,1-2H3 |
| InChIKey | QTDZZEMLJXPFBU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.05 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|