C19H18N2O3 — CID 18446972
4-[5-[4-[(2S)-butan-2-yl]oxyphenyl]-1,2,4-oxadiazol-3-yl]benzaldehyde (PubChem CID 18446972) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-[5-[4-[(2S)-butan-2-yl]oxyphenyl]-1,2,4-oxadiazol-3-yl]benzaldehyde.
| Compound Name | 4-[5-[4-[(2S)-butan-2-yl]oxyphenyl]-1,2,4-oxadiazol-3-yl]benzaldehyde |
|---|---|
| PubChem CID | 18446972 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 4-[5-[4-[(2S)-butan-2-yl]oxyphenyl]-1,2,4-oxadiazol-3-yl]benzaldehyde |
| SMILES | CC[C@H](C)Oc1ccc(-c2nc(-c3ccc(C=O)cc3)no2)cc1 |
| InChI | InChI=1S/C19H18N2O3/c1-3-13(2)23-17-10-8-16(9-11-17)19-20-18(21-24-19)15-6-4-14(12-22)5-7-15/h4-13H,3H2,1-2H3/t13-/m0/s1 |
| InChIKey | JGCZKTDUGDTUQS-ZDUSSCGKSA-N |
| XLogP | 4.39 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|