C36H34N2O7 — CID 102597311
[4-[5-[4-(4-butan-2-yloxybenzoyl)oxyphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-butan-2-yloxybenzoate (PubChem CID 102597311) has the molecular formula C36H34N2O7 and a molecular weight of 606.68 g/mol. Its IUPAC name is [4-[5-[4-(4-butan-2-yloxybenzoyl)oxyphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-butan-2-yloxybenzoate.
| Compound Name | [4-[5-[4-(4-butan-2-yloxybenzoyl)oxyphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-butan-2-yloxybenzoate |
|---|---|
| PubChem CID | 102597311 |
| Molecular Formula | C36H34N2O7 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | [4-[5-[4-(4-butan-2-yloxybenzoyl)oxyphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-butan-2-yloxybenzoate |
| SMILES | CCC(C)Oc1ccc(C(=O)Oc2ccc(-c3nnc(-c4ccc(OC(=O)c5ccc(OC(C)CC)cc5)cc4)o3)cc2)cc1 |
| InChI | InChI=1S/C36H34N2O7/c1-5-23(3)41-29-19-11-27(12-20-29)35(39)43-31-15-7-25(8-16-31)33-37-38-34(45-33)26-9-17-32(18-10-26)44-36(40)28-13-21-30(22-14-28)42-24(4)6-2/h7-24H,5-6H2,1-4H3 |
| InChIKey | JPNMNPKGPROTKH-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 109.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|