C14H8F2N2O4 — CID 18452509
6,7-difluoro-3-(4-nitrophenyl)-2H-1,3-benzoxazin-4-one (PubChem CID 18452509) has the molecular formula C14H8F2N2O4 and a molecular weight of 306.22 g/mol. Its IUPAC name is 6,7-difluoro-3-(4-nitrophenyl)-2H-1,3-benzoxazin-4-one.
| Compound Name | 6,7-difluoro-3-(4-nitrophenyl)-2H-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 18452509 |
| Molecular Formula | C14H8F2N2O4 |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 6,7-difluoro-3-(4-nitrophenyl)-2H-1,3-benzoxazin-4-one |
| SMILES | O=C1c2cc(F)c(F)cc2OCN1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H8F2N2O4/c15-11-5-10-13(6-12(11)16)22-7-17(14(10)19)8-1-3-9(4-2-8)18(20)21/h1-6H,7H2 |
| InChIKey | WGWLJYPEKXJWMS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|