About 5-amino-4,8-difluoronaphthalen-1-ol
5-amino-4,8-difluoronaphthalen-1-ol (PubChem CID 18457395) has the molecular formula C10H7F2NO
and a molecular weight of 195.17 g/mol. Its IUPAC name is 5-amino-4,8-difluoronaphthalen-1-ol.
Molecular Properties
| Compound Name | 5-amino-4,8-difluoronaphthalen-1-ol |
| PubChem CID | 18457395 |
| Molecular Formula | C10H7F2NO |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 5-amino-4,8-difluoronaphthalen-1-ol |
| SMILES | Nc1ccc(F)c2c(O)ccc(F)c12 |
| InChI | InChI=1S/C10H7F2NO/c11-5-2-4-8(14)10-6(12)1-3-7(13)9(5)10/h1-4,14H,13H2 |
| InChIKey | SWRYWKHFFYZHHR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4,8-difluoronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4,8-difluoronaphthalen-1-ol?
The IUPAC name of 5-amino-4,8-difluoronaphthalen-1-ol (CID 18457395) is 5-amino-4,8-difluoronaphthalen-1-ol.
What is the SMILES notation for 5-amino-4,8-difluoronaphthalen-1-ol?
The canonical SMILES for 5-amino-4,8-difluoronaphthalen-1-ol is Nc1ccc(F)c2c(O)ccc(F)c12.
What is the InChIKey of 5-amino-4,8-difluoronaphthalen-1-ol?
The InChIKey is SWRYWKHFFYZHHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2NO/c11-5-2-4-8(14)10-6(12)1-3-7(13)9(5)10/h1-4,14H,13H2.
What are the key properties of 5-amino-4,8-difluoronaphthalen-1-ol?
5-amino-4,8-difluoronaphthalen-1-ol has a molecular weight of 195.17 g/mol, XLogP of 2.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4,8-difluoronaphthalen-1-ol is sourced from PubChem (CID 18457395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).