C16H18N2O3S — CID 18458626
2-amino-4-methyl-5-[4-(2-methylpropanoylamino)phenyl]thiophene-3-carboxylic acid (PubChem CID 18458626) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is 2-amino-4-methyl-5-[4-(2-methylpropanoylamino)phenyl]thiophene-3-carboxylic acid.
| Compound Name | 2-amino-4-methyl-5-[4-(2-methylpropanoylamino)phenyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 18458626 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-amino-4-methyl-5-[4-(2-methylpropanoylamino)phenyl]thiophene-3-carboxylic acid |
| SMILES | Cc1c(-c2ccc(NC(=O)C(C)C)cc2)sc(N)c1C(=O)O |
| InChI | InChI=1S/C16H18N2O3S/c1-8(2)15(19)18-11-6-4-10(5-7-11)13-9(3)12(16(20)21)14(17)22-13/h4-8H,17H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | QPOPUCITRHLVJE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|