C26H26N4O8 — CID 18465663
3-[[2-[3-benzamido-4-oxo-1-(3-oxobutanoyl)-2,3-dihydro-1,5-benzodiazepin-5-yl]acetyl]amino]-4-oxobutanoic acid (PubChem CID 18465663) has the molecular formula C26H26N4O8 and a molecular weight of 522.51 g/mol. Its IUPAC name is 3-[[2-[3-benzamido-4-oxo-1-(3-oxobutanoyl)-2,3-dihydro-1,5-benzodiazepin-5-yl]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[3-benzamido-4-oxo-1-(3-oxobutanoyl)-2,3-dihydro-1,5-benzodiazepin-5-yl]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18465663 |
| Molecular Formula | C26H26N4O8 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 3-[[2-[3-benzamido-4-oxo-1-(3-oxobutanoyl)-2,3-dihydro-1,5-benzodiazepin-5-yl]acetyl]amino]-4-oxobutanoic acid |
| SMILES | CC(=O)CC(=O)N1CC(NC(=O)c2ccccc2)C(=O)N(CC(=O)NC(C=O)CC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C26H26N4O8/c1-16(32)11-23(34)29-13-19(28-25(37)17-7-3-2-4-8-17)26(38)30(21-10-6-5-9-20(21)29)14-22(33)27-18(15-31)12-24(35)36/h2-10,15,18-19H,11-14H2,1H3,(H,27,33)(H,28,37)(H,35,36) |
| InChIKey | XQAJTHDFWMTLDQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|