C26H26N4O7 — CID 59960917
N-[(3S)-1-acetyl-5-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-oxo-2-phenylacetamide (PubChem CID 59960917) has the molecular formula C26H26N4O7 and a molecular weight of 506.52 g/mol. Its IUPAC name is N-[(3S)-1-acetyl-5-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-oxo-2-phenylacetamide.
| Compound Name | N-[(3S)-1-acetyl-5-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-oxo-2-phenylacetamide |
|---|---|
| PubChem CID | 59960917 |
| Molecular Formula | C26H26N4O7 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | N-[(3S)-1-acetyl-5-[2-[[(2S)-1,4-dioxopentan-2-yl]amino]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-3-yl]-2-oxo-2-phenylacetamide |
| SMILES | CC(=O)C[C@@H](C=O)NC(=O)CN1C(=O)[C@@H](NC(=O)C(=O)c2ccccc2)CN(C(C)=O)c2ccccc21 |
| InChI | InChI=1S/C26H26N4O7/c1-16(32)12-19(15-31)27-23(34)14-30-22-11-7-6-10-21(22)29(17(2)33)13-20(26(30)37)28-25(36)24(35)18-8-4-3-5-9-18/h3-11,15,19-20H,12-14H2,1-2H3,(H,27,34)(H,28,36)/t19-,20-/m0/s1 |
| InChIKey | ROYGDIXJHMDDTG-PMACEKPBSA-N |
| XLogP | 0.42 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|