C25H24N4O8 — CID 59947680
(3S)-3-[[2-[(3S)-3-benzamido-4-oxo-1-(2-oxopropanoyl)-2,3-dihydro-1,5-benzodiazepin-5-yl]acetyl]amino]-4-oxobutanoic acid (PubChem CID 59947680) has the molecular formula C25H24N4O8 and a molecular weight of 508.49 g/mol. Its IUPAC name is (3S)-3-[[2-[(3S)-3-benzamido-4-oxo-1-(2-oxopropanoyl)-2,3-dihydro-1,5-benzodiazepin-5-yl]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[2-[(3S)-3-benzamido-4-oxo-1-(2-oxopropanoyl)-2,3-dihydro-1,5-benzodiazepin-5-yl]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59947680 |
| Molecular Formula | C25H24N4O8 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | (3S)-3-[[2-[(3S)-3-benzamido-4-oxo-1-(2-oxopropanoyl)-2,3-dihydro-1,5-benzodiazepin-5-yl]acetyl]amino]-4-oxobutanoic acid |
| SMILES | CC(=O)C(=O)N1C[C@H](NC(=O)c2ccccc2)C(=O)N(CC(=O)N[C@H](C=O)CC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C25H24N4O8/c1-15(31)24(36)28-12-18(27-23(35)16-7-3-2-4-8-16)25(37)29(20-10-6-5-9-19(20)28)13-21(32)26-17(14-30)11-22(33)34/h2-10,14,17-18H,11-13H2,1H3,(H,26,32)(H,27,35)(H,33,34)/t17-,18-/m0/s1 |
| InChIKey | SFDLATNEECKVAT-ROUUACIJSA-N |
| XLogP | -0.09 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|