C22H26N6O7 — CID 18465896
3-[[7-(1H-indole-2-carbonylamino)-6-oxido-10-oxo-1,2,3,4,5,7,8,9-octahydropyridazino[1,2-a][1,2,4]triazepin-6-ium-4-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 18465896) has the molecular formula C22H26N6O7 and a molecular weight of 486.49 g/mol. Its IUPAC name is 3-[[7-(1H-indole-2-carbonylamino)-6-oxido-10-oxo-1,2,3,4,5,7,8,9-octahydropyridazino[1,2-a][1,2,4]triazepin-6-ium-4-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[7-(1H-indole-2-carbonylamino)-6-oxido-10-oxo-1,2,3,4,5,7,8,9-octahydropyridazino[1,2-a][1,2,4]triazepin-6-ium-4-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18465896 |
| Molecular Formula | C22H26N6O7 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-[[7-(1H-indole-2-carbonylamino)-6-oxido-10-oxo-1,2,3,4,5,7,8,9-octahydropyridazino[1,2-a][1,2,4]triazepin-6-ium-4-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=CC(CC(=O)O)NC(=O)C1CNCN2C(=O)CCC(NC(=O)c3cc4ccccc4[nH]3)[N+]2([O-])C1 |
| InChI | InChI=1S/C22H26N6O7/c29-11-15(8-20(31)32)24-21(33)14-9-23-12-27-19(30)6-5-18(28(27,35)10-14)26-22(34)17-7-13-3-1-2-4-16(13)25-17/h1-4,7,11,14-15,18,23,25H,5-6,8-10,12H2,(H,24,33)(H,26,34)(H,31,32) |
| InChIKey | IGQAAXGMPZKDQY-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 183.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|