C19H28N4O6S — CID 18465786
tert-butyl 7-(benzenesulfonamido)-6-oxido-10-oxo-1,2,3,4,5,7,8,9-octahydropyridazino[1,2-a][1,2,4]triazepin-6-ium-4-carboxylate (PubChem CID 18465786) has the molecular formula C19H28N4O6S and a molecular weight of 440.52 g/mol. Its IUPAC name is tert-butyl 7-(benzenesulfonamido)-6-oxido-10-oxo-1,2,3,4,5,7,8,9-octahydropyridazino[1,2-a][1,2,4]triazepin-6-ium-4-carboxylate.
| Compound Name | tert-butyl 7-(benzenesulfonamido)-6-oxido-10-oxo-1,2,3,4,5,7,8,9-octahydropyridazino[1,2-a][1,2,4]triazepin-6-ium-4-carboxylate |
|---|---|
| PubChem CID | 18465786 |
| Molecular Formula | C19H28N4O6S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | tert-butyl 7-(benzenesulfonamido)-6-oxido-10-oxo-1,2,3,4,5,7,8,9-octahydropyridazino[1,2-a][1,2,4]triazepin-6-ium-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CNCN2C(=O)CCC(NS(=O)(=O)c3ccccc3)[N+]2([O-])C1 |
| InChI | InChI=1S/C19H28N4O6S/c1-19(2,3)29-18(25)14-11-20-13-22-17(24)10-9-16(23(22,26)12-14)21-30(27,28)15-7-5-4-6-8-15/h4-8,14,16,20-21H,9-13H2,1-3H3 |
| InChIKey | SOAOZHAZRNCKTH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|