C23H19Cl2NO3 — CID 18466455
1,3-dichloro-9,9-dimethyl-7-(phenylmethoxymethoxy)acridin-2-one (PubChem CID 18466455) has the molecular formula C23H19Cl2NO3 and a molecular weight of 428.32 g/mol. Its IUPAC name is 1,3-dichloro-9,9-dimethyl-7-(phenylmethoxymethoxy)acridin-2-one.
| Compound Name | 1,3-dichloro-9,9-dimethyl-7-(phenylmethoxymethoxy)acridin-2-one |
|---|---|
| PubChem CID | 18466455 |
| Molecular Formula | C23H19Cl2NO3 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 1,3-dichloro-9,9-dimethyl-7-(phenylmethoxymethoxy)acridin-2-one |
| SMILES | CC1(C)C2=C(Cl)C(=O)C(Cl)=CC2=Nc2ccc(OCOCc3ccccc3)cc21 |
| InChI | InChI=1S/C23H19Cl2NO3/c1-23(2)16-10-15(29-13-28-12-14-6-4-3-5-7-14)8-9-18(16)26-19-11-17(24)22(27)21(25)20(19)23/h3-11H,12-13H2,1-2H3 |
| InChIKey | YRPHZTMTNZCIBF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|