C41H39NO5 — CID 167478465
methyl 4-[4-[[3-methyl-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)indol-3-yl]methyl]phenoxy]butanoate (PubChem CID 167478465) has the molecular formula C41H39NO5 and a molecular weight of 625.77 g/mol. Its IUPAC name is methyl 4-[4-[[3-methyl-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)indol-3-yl]methyl]phenoxy]butanoate.
| Compound Name | methyl 4-[4-[[3-methyl-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)indol-3-yl]methyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 167478465 |
| Molecular Formula | C41H39NO5 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | methyl 4-[4-[[3-methyl-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)indol-3-yl]methyl]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc(CC2(C)C(c3ccc(OCc4ccccc4)cc3)=Nc3ccc(OCc4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C41H39NO5/c1-41(27-30-15-19-34(20-16-30)45-25-9-14-39(43)44-2)37-26-36(47-29-32-12-7-4-8-13-32)23-24-38(37)42-40(41)33-17-21-35(22-18-33)46-28-31-10-5-3-6-11-31/h3-8,10-13,15-24,26H,9,14,25,27-29H2,1-2H3 |
| InChIKey | ADPAVHLAYKRQDE-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|