About azanium 1-phenylprop-2-enylsulfanyl sulfate
azanium 1-phenylprop-2-enylsulfanyl sulfate (PubChem CID 18468866) has the molecular formula C9H13NO4S2
and a molecular weight of 263.34 g/mol. Its IUPAC name is azanium 1-phenylprop-2-enylsulfanyl sulfate.
Molecular Properties
| Compound Name | azanium 1-phenylprop-2-enylsulfanyl sulfate |
| PubChem CID | 18468866 |
| Molecular Formula | C9H13NO4S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | azanium 1-phenylprop-2-enylsulfanyl sulfate |
| SMILES | C=CC(SOS(=O)(=O)[O-])c1ccccc1.[NH4+] |
| InChI | InChI=1S/C9H10O4S2.H3N/c1-2-9(14-13-15(10,11)12)8-6-4-3-5-7-8;/h2-7,9H,1H2,(H,10,11,12);1H3 |
| InChIKey | XRBPBPMCQNMFCP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze azanium 1-phenylprop-2-enylsulfanyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 1-phenylprop-2-enylsulfanyl sulfate?
The IUPAC name of azanium 1-phenylprop-2-enylsulfanyl sulfate (CID 18468866) is azanium 1-phenylprop-2-enylsulfanyl sulfate.
What is the SMILES notation for azanium 1-phenylprop-2-enylsulfanyl sulfate?
The canonical SMILES for azanium 1-phenylprop-2-enylsulfanyl sulfate is C=CC(SOS(=O)(=O)[O-])c1ccccc1.[NH4+].
What is the InChIKey of azanium 1-phenylprop-2-enylsulfanyl sulfate?
The InChIKey is XRBPBPMCQNMFCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4S2.H3N/c1-2-9(14-13-15(10,11)12)8-6-4-3-5-7-8;/h2-7,9H,1H2,(H,10,11,12);1H3.
What are the key properties of azanium 1-phenylprop-2-enylsulfanyl sulfate?
azanium 1-phenylprop-2-enylsulfanyl sulfate has a molecular weight of 263.34 g/mol, XLogP of 2.41, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 1-phenylprop-2-enylsulfanyl sulfate is sourced from PubChem (CID 18468866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).