C15H21NO3SSi — CID 18469680
methyl (Z)-2-acetamido-3-[5-[dimethyl(prop-2-enyl)silyl]thiophen-2-yl]prop-2-enoate (PubChem CID 18469680) has the molecular formula C15H21NO3SSi and a molecular weight of 323.49 g/mol. Its IUPAC name is methyl (Z)-2-acetamido-3-[5-[dimethyl(prop-2-enyl)silyl]thiophen-2-yl]prop-2-enoate.
| Compound Name | methyl (Z)-2-acetamido-3-[5-[dimethyl(prop-2-enyl)silyl]thiophen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 18469680 |
| Molecular Formula | C15H21NO3SSi |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | methyl (Z)-2-acetamido-3-[5-[dimethyl(prop-2-enyl)silyl]thiophen-2-yl]prop-2-enoate |
| SMILES | C=CC[Si](C)(C)c1ccc(/C=C(\NC(C)=O)C(=O)OC)s1 |
| InChI | InChI=1S/C15H21NO3SSi/c1-6-9-21(4,5)14-8-7-12(20-14)10-13(15(18)19-3)16-11(2)17/h6-8,10H,1,9H2,2-5H3,(H,16,17)/b13-10- |
| InChIKey | ACLRGZMESJGYPF-RAXLEYEMSA-N |
| XLogP | 2.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|